CAS 884504-76-1

4-(Chloromethyl)-2-(3-fluorophenyl)-5-methyloxazole

Description:

4-(Chloromethyl)-2-(3-fluorophenyl)-5-methyloxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chloromethyl group indicates that there is a chlorine atom attached to a carbon chain that is further connected to the oxazole ring, enhancing its reactivity and potential for substitution reactions. The 3-fluorophenyl group contributes to the compound's overall polarity and may influence its biological activity, as fluorine can affect the electronic properties of the aromatic system. Additionally, the methyl group at the 5-position of the oxazole ring can impact the compound's sterics and solubility. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with biological targets. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₉ClFNO

InChI: InChI=1S/C11H9ClFNO/c1-7-10(6-12)14-11(15-7)8-3-2-4-9(13)5-8/h2-5H,6H2,1H3

InChI key: InChIKey=QOZYCDPIFFXHKK-UHFFFAOYSA-N

SMILES: C(Cl)C=1N=C(OC1C)C2=CC(F)=CC=C2

Synonyms:

• Oxazole, 4-(chloromethyl)-2-(3-fluorophenyl)-5-methyl-
• 4-(Chloromethyl)-2-(3-fluorophenyl)-5-methyloxazole

4-(chloromethyl)-2-(3-fluorophenyl)-5-methyl-1,3-oxazole

CAS: 884504-76-1

Formula: C₁₁H₉ClFNO

Purity: 95.0%

Molecular weight: 225.65

Ref: 10-F308644