CAS 884504-84-1

Ethyl 5-[(6-chloro-3-pyridinyl)carbonyl]-2-furancarboxylate

Description:

Ethyl 5-[(6-chloro-3-pyridinyl)carbonyl]-2-furancarboxylate, identified by its CAS number 884504-84-1, is a chemical compound characterized by its unique structure that combines a furan ring with a pyridine moiety. This compound features an ethyl ester functional group, which contributes to its solubility and reactivity. The presence of the chloro substituent on the pyridine ring enhances its biological activity and potential as a pharmaceutical agent. The furan ring is known for its aromatic properties and can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Additionally, the carbonyl group linked to the pyridine provides sites for further chemical modifications, which can be exploited in drug design and development. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement for precise characterization.

Formula: C₁₃H₁₀ClNO₄

InChI: InChI=1S/C13H10ClNO4/c1-2-18-13(17)10-5-4-9(19-10)12(16)8-3-6-11(14)15-7-8/h3-7H,2H2,1H3

InChI key: InChIKey=MXZJDHKUOGYCQS-UHFFFAOYSA-N

SMILES: C(=O)(C=1OC(C(OCC)=O)=CC1)C=2C=CC(Cl)=NC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(6-chloro-3-pyridinyl)carbonyl]-, ethyl ester
• Ethyl 5-[(6-Chloropyridin-3-Yl)Carbonyl]-2-Furoate
• Ethyl 5-[(6-chloro-3-pyridinyl)carbonyl]-2-furancarboxylate

2-chloro-5-(5-ethoxycarbonyl-2-furoyl)pyridine

CAS: 884504-84-1

Formula: C₁₃H₁₀ClNO₄

Purity: 97.0%

Molecular weight: 279.68

Ref: 10-F202267