CAS 884504-89-6
:4-piperidyl(2-pyridyl)methanol
Description:
4-Piperidyl(2-pyridyl)methanol is an organic compound characterized by its unique structure, which includes a piperidine ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, making it a versatile intermediate in organic synthesis. It is often used in medicinal chemistry for its potential biological activities, including interactions with various receptors or enzymes. The presence of both nitrogen-containing rings contributes to its polar nature, which can influence its solubility in different solvents. Additionally, the hydroxyl group (-OH) in the methanol part of the molecule can participate in hydrogen bonding, affecting its reactivity and interaction with other chemical species. The compound's stability, reactivity, and potential applications in drug development or as a building block in synthetic chemistry make it of interest in both academic and industrial research settings. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c14-11(9-4-7-12-8-5-9)10-3-1-2-6-13-10/h1-3,6,9,11-12,14H,4-5,7-8H2
SMILES:c1ccnc(c1)C(C1CCNCC1)O
Synonyms:- (piperidin-4-yl)(pyridine-2-yl)methanol
- 2-PyridineMethanol, a-4-piperidinyl-
- Piperidin-4-yl(pyridin-2-yl)methanol
- 2-Pyridinemethanol, α-4-piperidinyl-
- piperidin-4-yl(pyridin-2-yl)methanol(SALTDATA: FREE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
