CAS 884507-13-5
:3-Fluoro-N-methyl-2-pyridinemethanamine
Description:
3-Fluoro-N-methyl-2-pyridinemethanamine, identified by its CAS number 884507-13-5, is a chemical compound that features a pyridine ring substituted with a fluorine atom and an amine group. This compound is characterized by its molecular structure, which includes a pyridine moiety, a methyl group attached to the nitrogen atom, and a methanamine functional group. The presence of the fluorine atom can influence the compound's reactivity, polarity, and biological activity, making it of interest in medicinal chemistry and drug development. Typically, such compounds may exhibit properties like moderate to high solubility in polar solvents, and their amine functionality can participate in hydrogen bonding, affecting their interaction with biological targets. The compound's potential applications may include roles as intermediates in organic synthesis or as pharmacological agents, depending on its specific biological activity and pharmacokinetic properties. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties due to the nitrogen atom's influence on the aromatic system.
Formula:C7H9FN2
InChI:InChI=1S/C7H9FN2/c1-9-5-7-6(8)3-2-4-10-7/h2-4,9H,5H2,1H3
InChI key:InChIKey=CRJRGUJNAQPYJG-UHFFFAOYSA-N
SMILES:C(NC)C1=C(F)C=CC=N1
Synonyms:- 3-Fluoro-N-methylpyrid-2-ylmethylamine
- [(3-Fluoropyridin-2-yl)methyl](methyl)amine
- 1-(3-Fluoropyridin-2-yl)-N-methylmethanamine
- 3-Fluoro-N-methyl-2-pyridinemethanamine
- 2-Pyridinemethanamine, 3-fluoro-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
