CAS 884507-17-9

1-(1-methyl-1H-indol-5-yl)methanamine

Description:

1-(1-methyl-1H-indol-5-yl)methanamine, with the CAS number 884507-17-9, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a methanamine functional group, indicating the presence of an amine (-NH2) attached to a carbon that is also linked to the indole moiety. The presence of the methyl group on the indole ring contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its behavior in different chemical contexts. Overall, 1-(1-methyl-1H-indol-5-yl)methanamine is a compound of interest for further research in various scientific fields.

Formula: C₁₀H₁₂N₂

InChI: InChI=1/C10H12N2/c1-12-5-4-9-6-8(7-11)2-3-10(9)12/h2-6H,7,11H2,1H3

SMILES: Cn1ccc2cc(ccc12)CN

Synonyms:

• (1-methyl-1H-indol-5-yl)methylamine

(1-METHYL-1H-INDOL-5-YL)METHYLAMINE

CAS: 884507-17-9

Formula: C₁₀H₁₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.2157

Ref: IN-DA004GTQ

(1-Methyl-1H-indol-5-yl)methanamine

CAS: 884507-17-9

(1-Methyl-1H-indol-5-yl)methanamine

Purity: 97%

Molecular weight: 160.22g/mol

Ref: 54-OR73292

(1-Methyl-1H-indol-5-yl)methanamine

CAS: 884507-17-9

Formula: C₁₀H₁₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.22

Ref: 10-F231205