CAS 884507-29-3

2-thiomorpholin-4-ylpyridine-4-carboxylic acid

Description:

2-Thiomorpholin-4-ylpyridine-4-carboxylic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a carboxylic acid group and a thiomorpholine moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the carboxylic acid group. The thiomorpholine ring contributes to its overall stability and may influence its biological activity, making it of interest in medicinal chemistry. The compound may also exhibit specific reactivity patterns typical of carboxylic acids, such as esterification or amide formation. Additionally, its molecular structure suggests potential interactions with biological targets, which could be explored in drug development contexts. Overall, 2-thiomorpholin-4-ylpyridine-4-carboxylic acid represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₂N₂O₂S

InChI: InChI=1/C10H12N2O2S/c13-10(14)8-1-2-11-9(7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14)

SMILES: c1cnc(cc1C(=O)O)N1CCSCC1

Synonyms:

• 2-Thiomorpholinoisonicotinic Acid
• 4-Pyridinecarboxylic acid, 2-(4-thiomorpholinyl)-