CymitQuimica logo

CAS 884507-32-8

:

N-Methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzenemethanamine

Description:
N-Methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzenemethanamine, with the CAS number 884507-32-8, is a chemical compound characterized by its unique structure that includes a benzene ring substituted with an amine group and a 1,2,4-oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, and its molecular structure suggests potential biological activity, which may include antimicrobial or anti-inflammatory effects. The presence of the oxadiazole ring often contributes to the compound's stability and reactivity, making it of interest in medicinal chemistry and material science. Additionally, the methyl groups in the structure can influence its lipophilicity and overall pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would depend on its concentration and exposure levels. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-8-13-11(15-14-8)10-5-3-9(4-6-10)7-12-2/h3-6,12H,7H2,1-2H3
InChI key:InChIKey=MUCOLQGVWQXQMX-UHFFFAOYSA-N
SMILES:CC=1N=C(ON1)C2=CC=C(CNC)C=C2
Synonyms:
  • N-Methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzenemethanamine
  • Benzenemethanamine, N-methyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.