CAS 884507-36-2
:6-(2-Furanyl)-3-pyridinecarboxylic acid
Description:
6-(2-Furanyl)-3-pyridinecarboxylic acid, identified by its CAS number 884507-36-2, is an organic compound characterized by the presence of both a pyridine and a furan ring in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The furan moiety, a five-membered aromatic ring containing oxygen, imparts unique electronic properties, while the pyridine ring, a six-membered aromatic ring with nitrogen, enhances the compound's ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The presence of these heterocycles suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's solubility and stability can be influenced by the functional groups present, making it a subject of interest for further research in medicinal chemistry and material science. Overall, 6-(2-Furanyl)-3-pyridinecarboxylic acid exemplifies the diverse chemistry of heterocyclic compounds.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-10(13)7-3-4-8(11-6-7)9-2-1-5-14-9/h1-6H,(H,12,13)
InChI key:InChIKey=ALJRNVXLRKHVQF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N=C1)C2=CC=CO2
Synonyms:- 3-Pyridinecarboxylic acid, 6-(2-furanyl)-
- 6-(2-Furanyl)-3-pyridinecarboxylic acid
- 6-(2-Furyl)Nicotinic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
