CAS 884507-55-5

N-methyl-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanamine

Description:

N-methyl-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanamine, identified by its CAS number 884507-55-5, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a phenyl group substituted with a diazepane moiety, which contributes to its potential biological activity. The presence of the N-methyl group indicates that it is a tertiary amine, which can influence its solubility and reactivity. The compound may exhibit properties typical of psychoactive substances, given the presence of the diazepane ring, which is often associated with anxiolytic and sedative effects. Its molecular structure suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. However, detailed studies on its pharmacological profile, toxicity, and therapeutic applications would be necessary to fully understand its characteristics and potential uses. As with any chemical, proper handling and safety protocols should be observed due to the unknown effects of novel compounds.

Formula: C₁₅H₂₅N₃

InChI: InChI=1/C15H25N3/c1-16-12-14-4-6-15(7-5-14)13-18-9-3-8-17(2)10-11-18/h4-7,16H,3,8-13H2,1-2H3

SMILES: CNCc1ccc(cc1)CN1CCCN(C)CC1

N-Methyl-1-{4-[(4-methylhomopiperazin-1-yl)methyl]phenyl}methylamine

CAS: 884507-55-5

N-Methyl-1-{4-[(4-methylhomopiperazin-1-yl)methyl]phenyl}methylamine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 247.38g/mol

Ref: 54-OR12414