CAS 884535-06-2

4-Piperidinepropanol, 4-hydroxy-, hydrochloride (1:1)

Description:

4-Piperidinepropanol, 4-hydroxy-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basic properties. This substance features a hydroxyl group (-OH) attached to a propanol chain, enhancing its solubility in polar solvents and influencing its reactivity. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often exhibiting improved solubility in water. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. The compound may exhibit various biological activities, including potential effects on neurotransmitter systems, making it of interest in research related to neuropharmacology. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 4-Piperidinepropanol, 4-hydroxy-, hydrochloride (1:1) is a versatile compound with implications in both research and therapeutic contexts.

Formula: C₈H₁₇NO₂·ClH

InChI: InChI=1S/C8H17NO2.ClH/c10-7-1-2-8(11)3-5-9-6-4-8;/h9-11H,1-7H2;1H

InChI key: InChIKey=QBDFVBSGCWGISC-UHFFFAOYSA-N

SMILES: C(CCO)C1(O)CCNCC1.Cl

Synonyms:

• 4-Piperidinepropanol, 4-hydroxy-, hydrochloride
• 4-Piperidinepropanol, 4-hydroxy-, hydrochloride (1:1)

4-Hydroxy-4-Piperidinepropanol Hydrochloride

Controlled Product

CAS: 884535-06-2

Formula: C₈H₁₇NO₂·HCl

Color and Shape: Neat

Molecular weight: 195.69

Ref: TR-H952110