CAS 88456-94-4
:3-[3-(Decyloxy)-2-hydroxypropoxy]-1,2-propanediol
Description:
3-[3-(Decyloxy)-2-hydroxypropoxy]-1,2-propanediol, with the CAS number 88456-94-4, is a chemical compound that belongs to the class of glyceryl ethers. It features a propanediol backbone, which is substituted with a decyloxy group and a hydroxypropoxy group. This structure imparts both hydrophilic and hydrophobic characteristics, making it amphiphilic. Such compounds are often utilized in various applications, including as surfactants, emulsifiers, or solubilizers in cosmetic and pharmaceutical formulations. The presence of the decyloxy chain enhances its lipophilicity, while the hydroxy groups contribute to its solubility in water. The compound may exhibit low toxicity and good biodegradability, which are desirable traits in many industrial applications. Additionally, its molecular structure suggests potential for interactions with biological membranes, making it of interest in drug delivery systems. Overall, 3-[3-(Decyloxy)-2-hydroxypropoxy]-1,2-propanediol is characterized by its unique balance of hydrophilic and hydrophobic properties, which can be tailored for specific uses in various fields.
Formula:C16H34O5
InChI:InChI=1S/C16H34O5/c1-2-3-4-5-6-7-8-9-10-20-13-16(19)14-21-12-15(18)11-17/h15-19H,2-14H2,1H3
InChI key:InChIKey=WVYXRLHPNLXFLY-UHFFFAOYSA-N
SMILES:C(COCC(CO)O)(COCCCCCCCCCC)O
Synonyms:- 1,2-Propanediol, 3-[3-(decyloxy)-2-hydroxypropoxy]-
- 3-[3-(Decyloxy)-2-hydroxypropoxy]-1,2-propanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
