CAS 88460-52-0
:2-(2-Chlorophenyl)-2,3-dihydro-3-oxo-1H-isoindole-1-acetic acid
Description:
2-(2-Chlorophenyl)-2,3-dihydro-3-oxo-1H-isoindole-1-acetic acid, with the CAS number 88460-52-0, is a chemical compound that belongs to the class of isoindole derivatives. This substance typically exhibits a complex structure characterized by the presence of a chlorophenyl group and an isoindole framework, which contributes to its potential biological activity. The compound features a dihydro-3-oxo moiety, indicating the presence of a ketone functional group, and an acetic acid group, which may influence its solubility and reactivity. Such compounds are often studied for their pharmacological properties, including anti-inflammatory and analgesic effects. The chlorophenyl substitution can enhance lipophilicity, potentially affecting the compound's interaction with biological targets. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental conditions and the presence of other chemical species.
Formula:C16H12ClNO3
InChI:InChI=1S/C16H12ClNO3/c17-12-7-3-4-8-13(12)18-14(9-15(19)20)10-5-1-2-6-11(10)16(18)21/h1-8,14H,9H2,(H,19,20)
InChI key:InChIKey=DLDACYZBWHDSCD-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1N(C(=O)C=2C1=CC=CC2)C3=C(Cl)C=CC=C3
Synonyms:- 1H-Isoindole-1-acetic acid, 2-(2-chlorophenyl)-2,3-dihydro-3-oxo-
- 3-Oxo-2-(2-chlorophenyl)isoindoline-1-acetic acid
- 2-(2-Chlorophenyl)-2,3-dihydro-3-oxo-1H-isoindole-1-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Isoindole-1-acetic acid, 2-(2-chlorophenyl)-2,3-dihydro-3-oxo-
CAS:Formula:C16H12ClNO3Molecular weight:301.7244
