CAS 88460-73-5
:2-[5-[(Hydroxyimino)methyl]-2-furanyl]benzoic acid
Description:
2-[5-[(Hydroxyimino)methyl]-2-furanyl]benzoic acid, with the CAS number 88460-73-5, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a furan ring substituted with a hydroxyimino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity due to the presence of functional groups. The hydroxyimino group may impart specific reactivity, making it a candidate for various chemical transformations. Additionally, the presence of the furan ring can contribute to its biological activity, as furan derivatives are often explored for their pharmacological properties. The compound's acidity is influenced by the carboxylic acid group, which can participate in hydrogen bonding and affect its interactions in biological systems. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science, although specific biological or chemical behaviors would require further investigation.
Formula:C12H9NO4
InChI:InChI=1S/C12H9NO4/c14-12(15)10-4-2-1-3-9(10)11-6-5-8(17-11)7-13-16/h1-7,16H,(H,14,15)
InChI key:InChIKey=UKZIGUUVVNEBFL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C=2OC(C=NO)=CC2
Synonyms:- 2-[5-[(Hydroxyimino)methyl]-2-furanyl]benzoic acid
- Benzoic acid, 2-[5-[(hydroxyimino)methyl]-2-furanyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
