CymitQuimica logo

CAS 88460-96-2

:

Pentanamide, N-cyclohexyl-4-hydroxy-5-nitro-

Description:
Pentanamide, N-cyclohexyl-4-hydroxy-5-nitro- is an organic compound characterized by its amide functional group, which is derived from pentanoic acid. The presence of a cyclohexyl group contributes to its hydrophobic characteristics, while the hydroxy and nitro substituents introduce polar and electron-withdrawing properties, respectively. This compound typically exhibits moderate solubility in polar solvents due to the hydroxy group, while its overall structure may lead to limited solubility in non-polar solvents. The nitro group is known for its reactivity, often participating in electrophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in various fields, including medicinal chemistry and materials science. Safety and handling precautions should be observed, as compounds with nitro groups can be sensitive and may pose health risks. Overall, Pentanamide, N-cyclohexyl-4-hydroxy-5-nitro- is a complex molecule with unique properties that warrant further investigation.
Formula:C11H20N2O4
InChI:InChI=1S/C11H20N2O4/c14-10(8-13(16)17)6-7-11(15)12-9-4-2-1-3-5-9/h9-10,14H,1-8H2,(H,12,15)
InChI key:RQDWVSCSRRWIKF-UHFFFAOYSA-N
SMILES:C1CCC(CC1)NC(=O)CCC(C[N+](=O)[O-])O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.