CAS 884603-39-8

(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentan-1-amine

Description:

(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentan-1-amine, with the CAS number 884603-39-8, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pentane backbone with a methyl group and a phenyl ring substituted with a trifluoromethyl group, which significantly influences its chemical properties and biological activity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's interaction with biological targets. This compound is likely to exhibit amine characteristics, including basicity and potential for hydrogen bonding. Its stereochemistry, indicated by the (1R) configuration, suggests that it may have specific spatial arrangements that can influence its pharmacological effects. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the unique combination of functional groups and stereochemistry contributes to the compound's distinct chemical behavior and potential utility in various applications.

Formula: C₁₃H₁₈F₃N

InChI: InChI=1/C13H18F3N/c1-9(2)3-8-12(17)10-4-6-11(7-5-10)13(14,15)16/h4-7,9,12H,3,8,17H2,1-2H3/t12-/m1/s1

SMILES: CC(C)CC[C@H](c1ccc(cc1)C(F)(F)F)N

Synonyms:

• (1R)-4-Methyl-1-[4-(trifluoromethyl)phenyl]pentan-1-amine

(1R)-4-Methyl-1-[4-(trifluoromethyl)phenyl]pentylamine

CAS: 884603-39-8

Formula: C₁₃H₁₈F₃N

Purity: 95.0%

Molecular weight: 245.289

Ref: 10-F431940