CymitQuimica logo

CAS 88462-66-2

:

[[2-[(Trimethylsilyl)oxy]-3-butyn-1-yl]oxy]benzene

Description:
The chemical substance known as [[2-[(Trimethylsilyl)oxy]-3-butyn-1-yl]oxy]benzene, with the CAS number 88462-66-2, is an organic compound characterized by its unique structure that includes a benzene ring substituted with a butynyl group and a trimethylsilyl ether. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as stability and reactivity under certain conditions. The presence of the trimethylsilyl group enhances its solubility in organic solvents and can influence its reactivity, making it useful in various synthetic applications. Additionally, the butynyl moiety introduces a degree of unsaturation, which can participate in further chemical reactions, such as coupling or polymerization. The compound may also display specific physical properties, including boiling and melting points, which are influenced by its molecular structure and substituents. Overall, this substance is of interest in organic synthesis and materials science due to its functional groups and potential applications in creating more complex molecules.
Formula:C13H18O2Si
InChI:InChI=1S/C13H18O2Si/c1-5-12(15-16(2,3)4)11-14-13-9-7-6-8-10-13/h1,6-10,12H,11H2,2-4H3
InChI key:InChIKey=JTDCQKBBNGXEDL-UHFFFAOYSA-N
SMILES:O(CC(O[Si](C)(C)C)C#C)C1=CC=CC=C1
Synonyms:
  • 3-Trimethylsilyloxy-4-phenoxy-1-butyne
  • [[2-[(Trimethylsilyl)oxy]-3-butyn-1-yl]oxy]benzene
  • Silane, trimethyl[[1-(phenoxymethyl)-2-propynyl]oxy]-
  • Benzene, [[2-[(trimethylsilyl)oxy]-3-butyn-1-yl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.