CAS 88462-80-0
:(2S)-2,6-bis(benzyloxycarbonylamino)-6-oxo-hexanoic acid
Description:
(2S)-2,6-bis(benzyloxycarbonylamino)-6-oxo-hexanoic acid is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. This molecule features a hexanoic acid backbone, indicating it is a fatty acid derivative. The presence of two benzyloxycarbonylamino groups suggests that it has significant steric hindrance and potential for hydrogen bonding, which can influence its solubility and reactivity. The "6-oxo" designation indicates the presence of a carbonyl group at the sixth position, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of amino acids and peptides, such as chirality due to the presence of the (2S) configuration, which can affect its biological activity and interactions. Its applications may extend to pharmaceuticals, where it could serve as an intermediate in the synthesis of more complex molecules or as a building block in peptide synthesis. Overall, its unique structure and functional groups make it a compound of interest in both research and industrial contexts.
Formula:C22H24N2O7
InChI:InChI=1/C22H24N2O7/c25-19(24-22(29)31-15-17-10-5-2-6-11-17)13-7-12-18(20(26)27)23-21(28)30-14-16-8-3-1-4-9-16/h1-6,8-11,18H,7,12-15H2,(H,23,28)(H,26,27)(H,24,25,29)/t18-/m0/s1
SMILES:c1ccc(cc1)COC(=N[C@@H](CCCC(=NC(=O)OCc1ccccc1)O)C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
