CAS 88466-75-5

Phenylmethyl (3S)-3-(aminocarbonyl)-1-piperidinecarboxylate

Description:

Phenylmethyl (3S)-3-(aminocarbonyl)-1-piperidinecarboxylate, with the CAS number 88466-75-5, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is characterized by the presence of an aminocarbonyl group and a phenylmethyl substituent. This compound exhibits properties typical of piperidine derivatives, including potential biological activity, which may include analgesic or anti-inflammatory effects. Its structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. The presence of the carboxylate group indicates it may participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. Additionally, the stereochemistry at the 3-position (designated as (3S)) is crucial for its biological activity, as stereoisomers can exhibit significantly different pharmacological profiles. Overall, this compound's unique structural features contribute to its potential applications in pharmaceuticals and research.

Formula: C₁₄H₁₈N₂O₃

InChI: InChI=1S/C14H18N2O3/c15-13(17)12-7-4-8-16(9-12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H2,15,17)/t12-/m0/s1

InChI key: InChIKey=JVNTYSRHYYSZEM-LBPRGKRZSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C[C@@H](C(N)=O)CCC2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-(aminocarbonyl)-, phenylmethyl ester, (S)-
• Phenylmethyl (3S)-3-(aminocarbonyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(aminocarbonyl)-, phenylmethyl ester, (3S)-