CAS 88474-34-4

2-Methylpyrido[1,2-a]benzimidazole

Description:

2-Methylpyrido[1,2-a]benzimidazole is a heterocyclic compound characterized by its fused ring structure, which combines elements of both pyridine and benzimidazole. This compound features a methyl group attached to the pyridine ring, influencing its chemical properties and reactivity. It typically exhibits a range of biological activities, making it of interest in pharmaceutical research. The presence of nitrogen atoms in its structure contributes to its potential as a ligand in coordination chemistry and its ability to participate in hydrogen bonding. Additionally, 2-Methylpyrido[1,2-a]benzimidazole may display fluorescence properties, which can be useful in various analytical applications. Its solubility can vary depending on the solvent, and it may be sensitive to light and moisture. As with many heterocycles, it is important to consider its stability and reactivity under different conditions, particularly in the context of synthesis and application in drug development. Overall, this compound represents a significant area of study within organic and medicinal chemistry.

Formula: C₁₂H₁₀N₂

InChI: InChI=1S/C12H10N2/c1-9-6-7-12-13-10-4-2-3-5-11(10)14(12)8-9/h2-8H,1H3

InChI key: InChIKey=VOWKCNZFBZCZSC-UHFFFAOYSA-N

SMILES: CC1=CN2C=3C(N=C2C=C1)=CC=CC3

Synonyms:

• 2-Methylpyrido[1,2-a]benzimidazole
• Pyrido[1,2-a]benzimidazole, 2-methyl-
• 2-Methylbenzo[4,5]imidazo[1,2-a]pyridine