CAS 88478-46-0
:L-Phenylalanine, N-methyl-N-(1-L-tyrosyl-L-prolyl)-
Description:
L-Phenylalanine, N-methyl-N-(1-L-tyrosyl-L-prolyl)-, identified by the CAS number 88478-46-0, is a synthetic peptide derivative that incorporates the amino acids phenylalanine, tyrosine, and proline. This compound features a methyl group attached to the nitrogen of the phenylalanine moiety, which can influence its biological activity and solubility. The presence of the tyrosyl and prolyl residues contributes to its structural complexity and potential interactions in biological systems. Generally, peptides like this one can exhibit various properties, including specific binding affinities to receptors, potential neuroactive effects, and roles in signaling pathways. The molecular structure may also affect its stability, solubility in aqueous solutions, and susceptibility to enzymatic degradation. Such compounds are often studied for their potential therapeutic applications, including roles in neurotransmission and as precursors for neurotransmitter synthesis. However, detailed studies would be necessary to fully elucidate its pharmacological properties and potential uses in medicine or biochemistry.
Formula:C24H29N3O5
InChI:InChI=1S/C24H29N3O5/c1-26(21(24(31)32)15-16-6-3-2-4-7-16)23(30)20-8-5-13-27(20)22(29)19(25)14-17-9-11-18(28)12-10-17/h2-4,6-7,9-12,19-21,28H,5,8,13-15,25H2,1H3,(H,31,32)/t19-,20-,21-/m0/s1
InChI key:InChIKey=VCDFFCPOTRSSCO-ACRUOGEOSA-N
SMILES:C(N([C@@H](CC1=CC=CC=C1)C(O)=O)C)(=O)[C@H]2N(C([C@H](CC3=CC=C(O)C=C3)N)=O)CCC2
Synonyms:- L-Phenylalanine, N-methyl-N-(1-L-tyrosyl-L-prolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
