CAS 88482-18-2
:5-Iodo-2-methyl-4-pyridinecarboxylic acid
Description:
5-Iodo-2-methyl-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure, which includes a carboxylic acid functional group and an iodine substituent. This compound typically exhibits a pale yellow to off-white crystalline appearance. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The carboxylic acid group contributes to its acidity and solubility in polar solvents, while the methyl group provides steric hindrance that can affect its interactions with other molecules. This compound may be utilized in various applications, including as a building block in organic synthesis, in the development of pharmaceuticals, or as a ligand in coordination chemistry. Its unique structural features allow for potential applications in agrochemicals and materials science as well. As with many pyridine derivatives, it may exhibit specific biological activities, warranting further investigation into its pharmacological properties.
Formula:C7H6INO2
InChI:InChI=1S/C7H6INO2/c1-4-2-5(7(10)11)6(8)3-9-4/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=DWSKCYQLZAUJCV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(I)=CN=C(C)C1
Synonyms:- 5-Iodo-2-methyl-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 5-iodo-2-methyl-
- 5-Iodo-2-methylisonicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
