CymitQuimica logo

CAS 88486-02-6

:

Benzeneacetonitrile, 4-hydroxy-a-(phenylamino)-

Description:
Benzeneacetonitrile, 4-hydroxy-α-(phenylamino)-, with the CAS number 88486-02-6, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring, which contributes to its stability and hydrophobic properties, along with a nitrile group (-C≡N) that imparts polar characteristics. The presence of a hydroxyl group (-OH) and an amino group (-NH2) on the benzene ring enhances its reactivity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of various chemical products. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted to understand its handling and potential hazards. Overall, Benzeneacetonitrile, 4-hydroxy-α-(phenylamino)- is a versatile compound with significant implications in both industrial and research settings.
Formula:C14H12N2O
InChI:InChI=1S/C14H12N2O/c15-10-14(11-6-8-13(17)9-7-11)16-12-4-2-1-3-5-12/h1-9,14,16-17H
InChI key:VBMXIXLPVQUNHY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)NC(C#N)C2=CC=C(C=C2)O
Found 0 products.