CAS 88486-73-1
:1-Phenyl-2-(2,4,6-tribromophenoxy)ethanone
Description:
1-Phenyl-2-(2,4,6-tribromophenoxy)ethanone, with the CAS number 88486-73-1, is an organic compound characterized by its complex structure, which includes a phenyl group and a tribromophenoxy moiety attached to an ethanone backbone. This compound typically exhibits a high degree of bromination, which can influence its reactivity and physical properties, such as solubility and melting point. The presence of multiple bromine atoms often imparts significant hydrophobic characteristics, making it less soluble in polar solvents. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing effects of the bromine substituents, potentially affecting its behavior in chemical reactions and interactions with biological systems. Its applications may extend to fields such as materials science, pharmaceuticals, or as a reagent in organic synthesis, although specific uses would depend on further research and development. Safety data should be consulted, as brominated compounds can pose environmental and health risks.
Formula:C14H9Br3O2
InChI:InChI=1S/C14H9Br3O2/c15-10-6-11(16)14(12(17)7-10)19-8-13(18)9-4-2-1-3-5-9/h1-7H,8H2
InChI key:InChIKey=UECIAVXMYDTNRK-UHFFFAOYSA-N
SMILES:O(CC(=O)C1=CC=CC=C1)C2=C(Br)C=C(Br)C=C2Br
Synonyms:- Acetophenone, 2-(2,4,6-tribromophenoxy)-
- 1-Phenyl-2-(2,4,6-tribromophenoxy)ethan-1-one
- 1-Phenyl-2-(2,4,6-tribromophenoxy)ethanone
- Ethanone, 1-phenyl-2-(2,4,6-tribromophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
