
CAS 88489-86-5
:Methyl 4-(chlorothio)benzoate
Description:
Methyl 4-(chlorothio)benzoate, with the CAS number 88489-86-5, is an organic compound characterized by its ester functional group and the presence of a chlorothio substituent on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a distinct aromatic odor, which is common among benzoate esters. The presence of the chlorothio group introduces both chlorine and sulfur functionalities, which can influence its reactivity and solubility in various solvents. Methyl 4-(chlorothio)benzoate is often used in organic synthesis, particularly in the preparation of other chemical compounds, due to its ability to participate in nucleophilic substitution reactions. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory settings.
Formula:C8H7ClO2S
InChI:InChI=1S/C8H7ClO2S/c1-11-8(10)6-2-4-7(12-9)5-3-6/h2-5H,1H3
InChI key:InChIKey=MUCCVPQZMHCDHL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(SCl)C=C1
Synonyms:- Benzoic acid, 4-(chlorothio)-, methyl ester
- Methyl 4-(chlorothio)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
