
CAS 88489-88-7
:2-[4-(Chloromethyl)phenyl]-6-nitrobenzoxazole
Description:
2-[4-(Chloromethyl)phenyl]-6-nitrobenzoxazole, with the CAS number 88489-88-7, is an organic compound characterized by its complex structure that includes a benzoxazole ring, a nitro group, and a chloromethyl-substituted phenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the nitro group contributes to its potential as a chromophore, making it useful in various applications, including fluorescence and as a dye. The chloromethyl group can serve as a reactive site for further chemical modifications, enhancing its utility in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, this compound's unique structural features and functional groups make it a subject of interest in both academic and industrial chemistry.
Formula:C14H9ClN2O3
InChI:InChI=1S/C14H9ClN2O3/c15-8-9-1-3-10(4-2-9)14-16-12-6-5-11(17(18)19)7-13(12)20-14/h1-7H,8H2
InChI key:InChIKey=SCTQMSNQYOPPFB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(N=C(O2)C3=CC=C(CCl)C=C3)=CC1
Synonyms:- 2-[4-(Chloromethyl)phenyl]-6-nitrobenzoxazole
- 2-[4-(Chloromethyl)phenyl]-6-nitro-1,3-benzoxazole
- Benzoxazole, 2-[4-(chloromethyl)phenyl]-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
