CAS 88490-28-2
:3-(2-Fluorophenyl)-6-hydrazinylpyridazine
Description:
3-(2-Fluorophenyl)-6-hydrazinylpyridazine, with the CAS number 88490-28-2, is a chemical compound that belongs to the class of pyridazines, which are five-membered heterocyclic compounds containing two nitrogen atoms. This specific compound features a hydrazine functional group, which is characterized by the presence of a hydrazine (-NH-NH2) moiety, contributing to its potential reactivity and biological activity. The presence of a fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its electronic properties and lipophilicity. The compound may exhibit various characteristics such as solubility in organic solvents, potential biological activity, and reactivity due to the hydrazine group. Its structural features suggest possible applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies would be necessary to fully understand its properties, including stability, reactivity, and potential uses in various chemical or biological contexts.
Formula:C10H9FN4
InChI:InChI=1S/C10H9FN4/c11-8-4-2-1-3-7(8)9-5-6-10(13-12)15-14-9/h1-6H,12H2,(H,13,15)
InChI key:InChIKey=JXDVXDVLVQOYLX-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C=2C=CC(=NN)NN2
Synonyms:- 3(2H)-Pyridazinone, 6-(2-fluorophenyl)-, hydrazone
- [6-(2-Fluorophenyl)pyridazin-3-yl]hydrazine
- Pyridazine, 3-(2-fluorophenyl)-6-hydrazinyl-
- 3-(2-Fluorophenyl)-6-hydrazinylpyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.