CymitQuimica logo

CAS 88490-30-6

:

3-[4-(1,1-Dimethylethyl)phenyl]-6-hydrazinylpyridazine

Description:
3-[4-(1,1-Dimethylethyl)phenyl]-6-hydrazinylpyridazine, with the CAS number 88490-30-6, is a chemical compound characterized by its unique structural features, which include a pyridazine ring substituted with a hydrazine group and a bulky tert-butylphenyl moiety. This compound typically exhibits properties associated with both hydrazine derivatives and pyridazine-based structures, such as potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions, including oxidation and condensation. The tert-butyl group contributes to the compound's lipophilicity, potentially influencing its solubility and biological activity. Additionally, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases. Overall, the compound's unique structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H18N4
InChI:InChI=1S/C14H18N4/c1-14(2,3)11-6-4-10(5-7-11)12-8-9-13(16-15)18-17-12/h4-9H,15H2,1-3H3,(H,16,18)
InChI key:InChIKey=NNBUHGFPOMCKTH-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC=C(C=C1)C=2C=CC(=NN)NN2
Synonyms:
  • 3-[4-(1,1-Dimethylethyl)phenyl]-6-hydrazinylpyridazine
  • Pyridazine, 3-[4-(1,1-dimethylethyl)phenyl]-6-hydrazinyl-
  • 3(2H)-Pyridazinone, 6-[4-(1,1-dimethylethyl)phenyl]-, hydrazone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.