CAS 884905-30-0

1-(3-Fluoro-4-iodophenyl)cyclopropanecarboxylic acid

Description:

1-(3-Fluoro-4-iodophenyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a carboxylic acid functional group. The presence of a fluorine and an iodine atom on the phenyl ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The halogen substituents may also affect the compound's electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the cyclopropane moiety can impart strain, potentially leading to unique reactivity patterns. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the development of pharmaceuticals or agrochemicals. However, specific applications and biological activities would require empirical studies to elucidate its full potential.

Formula: C₁₀H₈FIO₂

InChI: InChI=1S/C10H8FIO2/c11-7-5-6(1-2-8(7)12)10(3-4-10)9(13)14/h1-2,5H,3-4H2,(H,13,14)

InChI key: InChIKey=OCHYLMHRQJJCDS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(F)=C(I)C=C2

Synonyms:

• Cyclopropanecarboxylic acid, 1-(3-fluoro-4-iodophenyl)-
• 1-(3-Fluoro-4-iodophenyl)cyclopropane-1-carboxylic acid
• 1-(3-Fluoro-4-iodophenyl)cyclopropanecarboxylic acid