
CAS 88491-72-9
:Pyridine, 2-methyl-, compd. with 1,3,5-trinitrobenzene (1:2)
Description:
The chemical substance known as "Pyridine, 2-methyl-, compd. with 1,3,5-trinitrobenzene (1:2)" is a complex formed from 2-methylpyridine and 1,3,5-trinitrobenzene. This compound typically exhibits characteristics associated with both its components. 2-Methylpyridine is a heterocyclic aromatic compound, known for its basicity and ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metals. It has a distinct odor and is soluble in water and organic solvents. On the other hand, 1,3,5-trinitrobenzene is a highly explosive nitro compound, known for its stability under certain conditions but can be sensitive to shock and heat. The combination of these two substances may result in unique properties, including altered solubility and reactivity profiles. The compound's CAS number, 88491-72-9, indicates its identification in chemical databases, facilitating research and safety assessments. Overall, this compound is of interest in both synthetic chemistry and materials science, particularly in the context of energetic materials.
Formula:C6H7N·2C6H3N3O6
InChI:InChI=1S/C6H3N3O6.C6H7N/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;1-6-4-2-3-5-7-6/h1-3H;2-5H,1H3
InChI key:InChIKey=MWYILYPHWPMFDF-UHFFFAOYSA-N
SMILES:CC1=CC=CC=N1.N(=O)(=O)C1=CC(N(=O)=O)=CC(N(=O)=O)=C1
Synonyms:- Pyridine, 2-methyl-, compd. with 1,3,5-trinitrobenzene (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyridine, 2-methyl-, compd. with 1,3,5-trinitrobenzene (1:2)
CAS:Formula:C18H13N7O12Molecular weight:519.3355
