CAS 88493-55-4
:a-Sexithienyl
Description:
α-Sexithienyl, with the CAS number 88493-55-4, is an organic compound belonging to the class of oligothiophenes, which are characterized by their conjugated systems of thiophene rings. This compound consists of six thiophene units linked in a linear fashion, contributing to its extended π-conjugation. α-Sexithienyl exhibits notable electronic properties, making it of interest in organic electronics, particularly in applications such as organic semiconductors and photovoltaic devices. The compound typically displays good solubility in organic solvents, which facilitates its processing and integration into various materials. Its optical properties include strong absorption in the UV-visible spectrum, and it can exhibit fluorescence, which is advantageous for applications in light-emitting devices. Additionally, α-Sexithienyl's structural characteristics allow for tunable electronic properties through functionalization, making it a subject of research in the development of advanced materials for electronic and optoelectronic applications. Overall, α-Sexithienyl is a significant compound in the field of organic chemistry and materials science.
Formula:C24H14S6
InChI:InChI=1/C24H14S6/c1-3-15(25-13-1)17-5-7-19(27-17)21-9-11-23(29-21)24-12-10-22(30-24)20-8-6-18(28-20)16-4-2-14-26-16/h1-14H
SMILES:c1cc(c2ccc(c3ccc(c4ccc(c5ccc(c6cccs6)s5)s4)s3)s2)sc1
Synonyms:- α-Sexithiophene
- Lt-S969
- α-6T
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
α-Sexithiophene (purified by sublimation)
CAS:Formula:C24H14S6Color and Shape:Light yellow to Brown powder to crystalMolecular weight:494.74




