CAS 88493-58-7

2-methyl-1,2,3,4-tetrahydroisoquinolin-7-ol

Description:

2-Methyl-1,2,3,4-tetrahydroisoquinolin-7-ol is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline framework. This compound features a hydroxyl group (-OH) at the 7-position and a methyl group (-CH3) at the 2-position of the isoquinoline ring system. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity and interaction with biological systems. This compound is of interest in medicinal chemistry due to its structural similarity to various bioactive molecules, which may suggest potential pharmacological properties. Its CAS number, 88493-58-7, allows for easy identification in chemical databases. As with many organic compounds, its properties such as melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other functional groups.

Formula: C₁₀H₁₃NO

InChI: InChI=1/C10H13NO/c1-11-5-4-8-2-3-10(12)6-9(8)7-11/h2-3,6,12H,4-5,7H2,1H3

SMILES: CN1CCc2ccc(cc2C1)O

2-Methyl-1,2,3,4-tetrahydroisoquinolin-7-ol

Controlled Product

CAS: 88493-58-7

Formula: C₁₀H₁₃NO

Color and Shape: Neat

Molecular weight: 163.216

Ref: TR-M331455