CymitQuimica logo

CAS 88493-69-0

:

1,2,3,4-Tetrahydro-2-methyl-5-(phenylmethoxy)isoquinoline

Description:
1,2,3,4-Tetrahydro-2-methyl-5-(phenylmethoxy)isoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic system containing a benzene ring fused to a pyridine-like ring. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the isoquinoline framework, resulting in a saturated form. The presence of a methyl group at the 2-position and a phenylmethoxy group at the 5-position contributes to its unique chemical properties and potential biological activities. The molecular structure suggests that it may exhibit interesting pharmacological effects, possibly related to its interaction with neurotransmitter systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development. Its CAS number, 88493-69-0, allows for easy identification and reference in chemical databases and literature.
Formula:C17H19NO
InChI:InChI=1S/C17H19NO/c1-18-11-10-16-15(12-18)8-5-9-17(16)19-13-14-6-3-2-4-7-14/h2-9H,10-13H2,1H3
InChI key:InChIKey=FCFDSUNZTJFEQJ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(=CC=C2)CN(C)CC3
Synonyms:
  • 1,2,3,4-Tetrahydro-2-methyl-5-(phenylmethoxy)isoquinoline
  • Isoquinoline, 1,2,3,4-tetrahydro-2-methyl-5-(phenylmethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.