CAS 88495-54-9
:L-1-Boc-Nipecotic acid
Description:
L-1-Boc-Nipecotic acid, with the CAS number 88495-54-9, is a chemical compound that belongs to the class of amino acids and derivatives. It features a bicyclic structure derived from nipecotic acid, which is a piperidine derivative. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in organic synthesis, particularly in peptide chemistry, to protect the amino group during reactions. This compound is characterized by its ability to participate in various chemical reactions, making it useful in the synthesis of pharmaceuticals and other bioactive molecules. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the Boc group enhances its stability and facilitates its handling in laboratory settings. L-1-Boc-Nipecotic acid is of interest in medicinal chemistry due to its potential applications in the development of drugs targeting neurological conditions, given the biological relevance of nipecotic acid derivatives. As with all chemical substances, proper safety measures should be observed when handling this compound.
Formula:C11H19NO4
InChI:InChI=1/C11H19NO4/c1-11(2,3)16-10(15)12-6-4-5-8(7-12)9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/t8-/m0/s1
SMILES:CC(C)(C)OC(=O)N1CCC[C@@H](C1)C(=O)O
Synonyms:- (S)-Boc-Nip-OH
- (S)-N-Boc-piperidine-3-carboxylic acid
- 1,3-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) ester, (3S)-
- 3-S-(+)-BOC-piperidinecarboxylic acid
- (3S)-1-(tert-butoxycarbonyl)piperidine-3-carboxylate
- (3S)-1-(tert-butoxycarbonyl)piperidine-3-carboxylic acid
- S-1-Boc-Nipecotic acid
- (S)-(+)-N-Boc-nipecotic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Boc-L-nipecotic acid, 97%
CAS:1-Boc-L-nipecotic acid is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or
Formula:C11H19NO4Purity:97%Molecular weight:229.28(S)-1-(tert-Butoxycarbonyl)piperidine-3-carboxylic acid
CAS:Formula:C11H19NO4Purity:96%Color and Shape:SolidMolecular weight:229.2729(S)-1-Boc-Nipecotic acid
CAS:Formula:C11H19NO4Purity:96%Color and Shape:SolidMolecular weight:229.276BOC-Nipecotic Acid extrapure, 99%
CAS:Formula:C11H19NO4Purity:min. 99%Color and Shape:White to off-white, Crystalline powderMolecular weight:229.27




