CAS 88497-27-2

6-bromopyridazin-3-amine

Description:

6-Bromopyridazin-3-amine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 6-position and an amino group at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its structure suggests potential use in the synthesis of various pharmaceuticals or agrochemicals, as derivatives of pyridazine are often explored for their biological activities. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and specific conditions. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 6-bromopyridazin-3-amine is of interest for further research in organic synthesis and drug development.

Formula: C₄H₄BrN₃

InChI: InChI=1/C4H4BrN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8)

SMILES: c1cc(=N)[nH]nc1Br

Synonyms:

• 3-Pyridazinamine, 6-Bromo-
• 6-Bromo-3-Pyridazinamine

3-Amino-6-bromopyridazine

CAS: 88497-27-2

Formula: C₄H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.9987

Ref: IN-DA0036AI

6-Bromopyridazin-3-amine

CAS: 88497-27-2

6-Bromopyridazin-3-amine

Purity: 98%

Molecular weight: 174.00g/mol

Ref: 54-OR302543

6-Bromopyridazin-3-amine

CAS: 88497-27-2

Formula: C₄H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.001

Ref: 10-F064946