CAS 884982-97-2

ethyl 3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazole-5-carboxylate

Description:

Ethyl 3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a benzodioxole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and material science. The presence of the oxadiazole ring suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development due to its ability to interact with biological targets. The benzodioxole group may contribute to its stability and influence its electronic properties. Additionally, the ethyl ester functional group can enhance solubility and bioavailability. Overall, this compound's structural features suggest it may possess interesting chemical reactivity and biological activity, warranting further investigation for potential applications in various fields, including drug discovery and organic synthesis.

Formula: C₁₂H₁₀N₂O₅

InChI: InChI=1/C12H10N2O5/c1-2-16-12(15)11-13-10(14-19-11)7-3-4-8-9(5-7)18-6-17-8/h3-5H,2,6H2,1H3

SMILES: CCOC(=O)c1nc(c2ccc3c(c2)OCO3)no1

Synonyms:

• 1,2,4-Oxadiazole-5-carboxylic acid, 3-(1,3-benzodioxol-5-yl)-, ethyl ester