CAS 88499-96-1

7-Chloro-2,4-dimethylquinoline

Description:

7-Chloro-2,4-dimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a fused benzene and pyridine ring. This compound features a chlorine atom at the 7-position and two methyl groups at the 2 and 4 positions of the quinoline ring. It is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of the chlorine atom and methyl groups can influence its chemical reactivity, making it a potential candidate for various applications in medicinal chemistry and material science. Additionally, quinoline derivatives are known for their biological activities, including antimicrobial and antimalarial properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₁₁H₁₀ClN

InChI: InChI=1/C11H10ClN/c1-7-5-8(2)13-11-6-9(12)3-4-10(7)11/h3-6H,1-2H3

SMILES: Cc1cc(C)nc2cc(ccc12)Cl

7-Chloro-2,4-dimethylquinoline

CAS: 88499-96-1

7-Chloro-2,4-dimethylquinoline

Purity: ≥95%

Molecular weight: 191.66g/mol

Ref: 54-OR307822