CAS 885-22-3
:(dimethylamino)(naphthalen-1-yl)acetonitrile
Description:
Dimethylamino(naphthalen-1-yl)acetonitrile, with the CAS number 885-22-3, is an organic compound characterized by its structure, which includes a naphthalene ring and a dimethylamino group attached to an acetonitrile moiety. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the dimethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the naphthalene component contributes to its aromatic characteristics, which can influence its reactivity and solubility in organic solvents. Safety data indicates that, like many organic nitriles, it should be handled with care due to potential toxicity and irritant properties. Overall, this compound exemplifies the diverse functionalities that can arise from combining different organic moieties in a single molecule.
Formula:C14H14N2
InChI:InChI=1/C14H14N2/c1-16(2)14(10-15)13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14H,1-2H3
SMILES:CN(C)C(C#N)c1cccc2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.