CAS 885-44-9

5-chloro-1-(1,1-dioxidotetrahydrothiophen-3-yl)-3-methyl-1H-pyrazole-4-carbaldehyde

Description:

5-Chloro-1-(1,1-dioxidotetrahydrothiophen-3-yl)-3-methyl-1H-pyrazole-4-carbaldehyde, with the CAS number 885-44-9, is a chemical compound that features a complex structure incorporating a pyrazole ring, a chloro substituent, and a tetrahydrothiophene moiety. This compound is characterized by its unique functional groups, including an aldehyde group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloro group enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The dioxido group in the tetrahydrothiophene ring may impart specific electronic properties, influencing the compound's stability and reactivity. Additionally, the compound's molecular structure suggests potential biological activity, which could be explored in medicinal chemistry. Overall, this compound exemplifies the diversity of heterocyclic chemistry and its applications in developing new materials and pharmaceuticals.

Formula: C₉H₁₁ClN₂O₃S

InChI: InChI=1/C9H11ClN2O3S/c1-6-8(4-13)9(10)12(11-6)7-2-3-16(14,15)5-7/h4,7H,2-3,5H2,1H3

SMILES: Cc1c(C=O)c(Cl)n(C2CCS(=O)(=O)C2)n1

5-Chloro-1-(1,1-dioxidotetrahydrothien-3-yl)-3-methyl-1H-pyrazole-4-carbaldehyde

CAS: 885-44-9

Versatile small molecule scaffold

Formula: C₉H₁₁ClN₂O₃S

Purity: Min. 95%

Molecular weight: 262.71 g/mol

Ref: 3D-AAA88544