CymitQuimica logo

CAS 885044-51-9

:

3,3′-Dimethyl 5-[[(1,1-dimethylethoxy)carbonyl]amino]-5′-hydroxy[1,1′-biphenyl]-3,3′-dicarboxylate

Description:
3,3′-Dimethyl 5-[[(1,1-dimethylethoxy)carbonyl]amino]-5′-hydroxy[1,1′-biphenyl]-3,3′-dicarboxylate, with CAS number 885044-51-9, is a complex organic compound characterized by its biphenyl structure, which features multiple functional groups including carboxylate and amino moieties. This compound is likely to exhibit properties typical of derivatives of biphenyl, such as potential applications in pharmaceuticals or agrochemicals due to its structural versatility. The presence of dimethyl and dimethylethoxy groups suggests enhanced lipophilicity, which may influence its solubility and bioavailability. Additionally, the hydroxyl group can participate in hydrogen bonding, potentially affecting its reactivity and interactions with biological targets. The compound's dicarboxylate nature indicates it may engage in acid-base chemistry, making it relevant in various chemical reactions. Overall, the unique combination of functional groups in this molecule suggests it could have specific applications in synthetic chemistry or medicinal chemistry, although detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C21H23NO7
InChI:InChI=1S/C21H23NO7/c1-21(2,3)29-20(26)22-16-8-12(6-14(9-16)18(24)27-4)13-7-15(19(25)28-5)11-17(23)10-13/h6-11,23H,1-5H3,(H,22,26)
InChI key:InChIKey=CDGDVSGHUWVORY-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C=1C=C(C=C(C(OC)=O)C1)C2=CC(C(OC)=O)=CC(O)=C2
Synonyms:
  • 3,3′-Dimethyl 5-[[(1,1-dimethylethoxy)carbonyl]amino]-5′-hydroxy[1,1′-biphenyl]-3,3′-dicarboxylate
  • [1,1′-Biphenyl]-3,3′-dicarboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-5′-hydroxy-, 3,3′-dimethyl ester
  • [1,1′-Biphenyl]-3,3′-dicarboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-5′-hydroxy-, dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.