CAS 885049-08-1
:tert-Butyl 4-carbamimidamidopiperidine-1-carboxylate hydrochloride (1:1)
Description:
Tert-Butyl 4-carbamimidamidopiperidine-1-carboxylate hydrochloride (1:1), with the CAS number 885049-08-1, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a tert-butyl group that enhances its lipophilicity. The presence of a carbamimidamidopiperidine moiety suggests potential biological activity, possibly as a pharmacological agent. The hydrochloride salt form indicates that it is a stable, water-soluble compound, which is advantageous for various applications, including in medicinal chemistry. This compound may exhibit properties such as basicity due to the presence of the amine groups, and it may participate in hydrogen bonding due to its functional groups. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be of interest in research related to drug development or as a biochemical probe. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C11H23ClN4O2
InChI:InChI=1/C11H22N4O2.ClH/c1-11(2,3)17-10(16)15-6-4-8(5-7-15)14-9(12)13;/h8H,4-7H2,1-3H3,(H4,12,13,14);1H
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)NC(=N)N.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-guanidinopiperidine-1-carboxylate hydrochloride
CAS:Formula:C11H23ClN4O2Molecular weight:278.7789
