CAS 88509-91-5

9-hydroxy-7-(3-hydroxy-4,5-dimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-8-one

Description:

9-hydroxy-7-(3-hydroxy-4,5-dimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-8-one, with the CAS number 88509-91-5, is a chemical compound that belongs to the class of flavonoids, specifically a type of chromone. This compound features a complex structure characterized by a chromenone core fused with a dioxole ring and substituted with hydroxyl and methoxy groups, which contribute to its potential biological activity. The presence of multiple hydroxyl and methoxy groups enhances its solubility and reactivity, making it of interest in various fields, including medicinal chemistry and natural product research. Flavonoids are known for their antioxidant properties, and this compound may exhibit similar effects, potentially influencing cellular signaling pathways and providing protective effects against oxidative stress. Its unique structural features may also suggest potential applications in pharmacology, particularly in the development of therapeutic agents. Further studies would be necessary to fully elucidate its biological activities and potential uses.

Formula: C₁₈H₁₄O₈

InChI: InChI=1/C18H14O8/c1-22-12-4-8(3-10(19)17(12)23-2)9-6-24-11-5-13-18(26-7-25-13)16(21)14(11)15(9)20/h3-6,19,21H,7H2,1-2H3

SMILES: COc1cc(cc(c1OC)O)c1coc2cc3c(c(c2c1=O)O)OCO3

Synonyms:

• 5,3'-Dihydroxy-4',5'-dimethoxy-6,7-methylenedioxyisoflavone
• 8H-1,3-Dioxolo(4,5-g)(1)benzopyran-8-one, 9-hydroxy-7-(3-hydroxy-4,5-dimethoxyphenyl)-

Dichotomitin

CAS: 88509-91-5

Formula: C₁₈H₁₄O₈

Purity: 98%

Molecular weight: 358.299

Ref: IN-DA00H0RN

Dichotomitin

CAS: 88509-91-5

Dichotomitin

Purity: ≥98%

Molecular weight: 358.3g/mol

Ref: 54-BUP16289

Dichotomitin

CAS: 88509-91-5

Formula: C₁₈H₁₄O₈

Molecular weight: 358.30

Ref: 7W-GY6388

Dichotomitin

CAS: 88509-91-5

Formula: C₁₈H₁₄O₈

Purity: 95%~99%

Molecular weight: 358.302

Ref: BP-BP3121

Dichotomitin

CAS: 88509-91-5

Dichotomitin is an natural isoflavonoid isolated from the rhizomes of Belamcanda chinensis (L.) DC.

Formula: C₁₈H₁₄O₈

Purity: 99.56% - 99.64%

Color and Shape: Solid

Molecular weight: 358.3

Ref: TM-T8212

Dichotomitin

CAS: 88509-91-5

Dichotomitin is a natural compound, which is a type of secondary metabolite derived from biological sources, specifically fungi of the genus Dichotomitus. This compound exhibits unique properties due to its complex chemical structure, which has shown promising antimicrobial activity in preliminary studies. The mode of action of Dichotomitin involves interfering with the metabolic processes of certain microbial cells, potentially inhibiting their growth and proliferation.

Formula: C₁₈H₁₄O₈

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 358.3 g/mol

Ref: 3D-FD74244