CAS 88510-08-1

2-Phenylethyl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside

Description:

2-Phenylethyl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside is a glycoside compound characterized by its complex structure, which includes a phenylethyl group and a glucopyranoside moiety linked to a 6-deoxy-α-L-mannopyranosyl unit. This compound is notable for its potential biological activities, including antioxidant and antimicrobial properties, which are often attributed to the phenolic components of the phenylethyl group. The presence of sugar moieties enhances its solubility in water and may influence its interaction with biological systems, making it of interest in pharmacological and nutritional studies. Its structural features suggest that it may participate in various biochemical pathways, potentially serving as a precursor for the synthesis of more complex molecules. Additionally, the specific stereochemistry of the sugar units plays a crucial role in determining the compound's reactivity and biological function. Overall, 2-Phenylethyl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside exemplifies the intricate relationship between structure and function in organic compounds.

Formula: C₂₀H₃₀O₁₀

InChI: InChI=1S/C20H30O10/c1-10-13(21)15(23)17(25)20(29-10)28-9-12-14(22)16(24)18(26)19(30-12)27-8-7-11-5-3-2-4-6-11/h2-6,10,12-26H,7-9H2,1H3/t10-,12+,13-,14+,15+,16-,17+,18+,19+,20+/m0/s1

InChI key: InChIKey=OKUGUNDXBGUFPA-OCGSKHJZSA-N

SMILES: C(O[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O1)[C@H]2O[C@@H](OCCC3=CC=CC=C3)[C@H](O)[C@@H](O)[C@@H]2O

Synonyms:

• 2-Phenylethyl D-rutinoside
• β-D-Glucopyranoside, 2-phenylethyl 6-O-(6-deoxy-α-L-mannopyranosyl)-
• 2-Phenylethyl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside
• Phenethyl O-α-L-rhamnopyranosyl-(1→6)-β-D-glucopyranoside

2-Phenylethyl D-rutinoside

CAS: 88510-08-1

Formula: C₂₀H₃₀O₁₀

Color and Shape: Neat

Ref: TR-P930645