CAS 88511-48-2
:pyrimidine-2-carboxamide
Description:
Pyrimidine-2-carboxamide, identified by its CAS number 88511-48-2, is a heterocyclic organic compound featuring a pyrimidine ring substituted with a carboxamide group at the 2-position. This compound exhibits characteristics typical of pyrimidines, including aromaticity and the presence of nitrogen atoms in the ring, which contribute to its basicity and potential for hydrogen bonding. Pyrimidine-2-carboxamide is generally soluble in polar solvents due to its ability to form hydrogen bonds, making it useful in various chemical reactions and applications. The carboxamide functional group enhances its reactivity, allowing it to participate in nucleophilic substitutions and other organic transformations. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability under standard conditions and the ability to form derivatives further expand its utility in synthetic chemistry and medicinal applications. Overall, pyrimidine-2-carboxamide is a versatile compound with significant implications in both organic synthesis and biological research.
Formula:C5H5N3O
InChI:InChI=1/C5H5N3O/c6-4(9)5-7-2-1-3-8-5/h1-3H,(H2,6,9)
SMILES:c1cnc(C(=O)N)nc1
Synonyms:- 2-Pyrimidinecarboxamide
- 88511-48-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrimidine-2-carboxamide
CAS:Pyrimidine-2-carboxamide is an amide that has been shown to have antiinflammatory activity. It has been clinically studied for the treatment of diabetic neuropathy, inflammatory bowel disease, and autoimmune diseases. Pyrimidine-2-carboxamide inhibits the production of proinflammatory cytokines by inhibiting hydrogen bond formation between the amide group and DNA bases. This compound also has a number of other biological activities, including antiviral effects against HIV infection and cancer. Pyrimidine-2-carboxamide is a chemotherapeutic agent that has been used in clinical trials for bladder cancer and bowel disease.
Formula:C5H5N3OPurity:Min. 95%Molecular weight:123.11 g/mol



