
CAS 88511-88-0
:2-Hydroxy-1-(2-thienyl)ethanone
Description:
2-Hydroxy-1-(2-thienyl)ethanone, also known as thienylacetone, is an organic compound characterized by the presence of a hydroxyl group and a thienyl group attached to an ethanone backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic thienyl ring. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and oxidation. Additionally, the thienyl moiety can influence the compound's electronic properties, making it of interest in fields such as organic synthesis and materials science. Its unique structure may also impart specific biological activities, making it a subject of study in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H6O2S
InChI:InChI=1S/C6H6O2S/c7-4-5(8)6-2-1-3-9-6/h1-3,7H,4H2
InChI key:InChIKey=RWYQCSIKKZSICV-UHFFFAOYSA-N
SMILES:C(CO)(=O)C1=CC=CS1
Synonyms:- 2-Hydroxy-1-(thien-2-yl)ethan-1-one
- Ethanone, 2-hydroxy-1-(2-thienyl)-
- Ketone, hydroxymethyl 2-thienyl
- 2-Hydroxy-1-(2-thienyl)ethanone
- 2-(Hydroxyacetyl)thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
