CymitQuimica logo

CAS 885126-34-1

:

Benzamide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-methyl-

Description:
Benzamide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-methyl- is a chemical compound characterized by its structural features, which include a benzamide core with a methyl group and a thioether linkage to a 3-iodo-1H-indazole moiety. This compound typically exhibits properties associated with both the benzamide and indazole functional groups, such as potential biological activity and solubility in organic solvents. The presence of the iodine atom may enhance its reactivity and influence its pharmacological properties. The thioether linkage can also affect the compound's stability and interaction with biological targets. As a member of the indazole family, it may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies and evaluations in biological systems. Overall, this compound represents a unique combination of structural elements that may contribute to its potential utility in research and therapeutic contexts.
Formula:C15H12IN3OS
InChI:InChI=1S/C15H12IN3OS/c1-17-15(20)11-4-2-3-5-13(11)21-9-6-7-10-12(8-9)18-19-14(10)16/h2-8H,1H3,(H,17,20)(H,18,19)
InChI key:VHZLHFNNNDGPLF-UHFFFAOYSA-N
SMILES:CNC(=O)C1=CC=CC=C1SC2=CC3=NNC(=C3C=C2)I
Synonyms:
  • 2-(3-Iodo-1H-Indazol-6-Ylthio)-N-Methylbenzamide
  • 2-[(3-iodo-1H-indazol-6-yl)thio]-N-methyl-Benzamide
  • 2-((3-Iodo-1H-Indazol-6-Yl)Thio)-N-Methylbenzamide
Found 5 products.