
CAS 88514-37-8
:3-(1H-Indol-3-ylmethyl)-4(3H)-quinazolinone
Description:
3-(1H-Indol-3-ylmethyl)-4(3H)-quinazolinone, identified by its CAS number 88514-37-8, is a chemical compound that features a quinazolinone core structure fused with an indole moiety. This compound is characterized by its heterocyclic structure, which includes both nitrogen-containing rings, contributing to its potential biological activity. The presence of the indole group suggests possible interactions with biological targets, making it of interest in medicinal chemistry, particularly for its potential pharmacological properties. The compound may exhibit properties such as anti-inflammatory, anticancer, or antimicrobial activities, although specific biological effects would depend on further empirical studies. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical entities. As with many heterocycles, the electronic properties imparted by the nitrogen atoms can influence its reactivity and interaction with other molecules, making it a subject of interest for further research in drug development and synthetic chemistry.
Formula:C17H13N3O
InChI:InChI=1S/C17H13N3O/c21-17-14-6-2-4-8-16(14)19-11-20(17)10-12-9-18-15-7-3-1-5-13(12)15/h1-9,11,18H,10H2
InChI key:InChIKey=FWIDZNGJFPFTJD-UHFFFAOYSA-N
SMILES:C(C=1C=2C(NC1)=CC=CC2)N3C(=O)C=4C(N=C3)=CC=CC4
Synonyms:- 3-(1H-Indol-3-ylmethyl)-4(3H)-quinazolinone
- 4(3H)-Quinazolinone, 3-(1H-indol-3-ylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
