CAS 885167-73-7

(3-Chloropyridin-2-yl)acetic acid

Description:

(3-Chloropyridin-2-yl)acetic acid is a chemical compound characterized by its pyridine ring structure, which includes a chlorine substituent at the 3-position and an acetic acid functional group attached at the 2-position. This compound typically appears as a solid or a liquid, depending on the specific conditions, and is soluble in polar solvents due to the presence of the carboxylic acid group. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The chlorine atom introduces unique reactivity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the pyridine ring may contribute to its potential as a ligand in coordination chemistry. Overall, (3-Chloropyridin-2-yl)acetic acid is a versatile compound with applications in organic synthesis and medicinal chemistry, reflecting the importance of halogenated heterocycles in drug development.

Formula: C₇H₆ClNO₂

InChI: InChI=1/C7H6ClNO2/c8-5-2-1-3-9-6(5)4-7(10)11/h1-3H,4H2,(H,10,11)

SMILES: c1cc(c(CC(=O)O)nc1)Cl

Synonyms:

• 2-Pyridineacetic Acid, 3-Chloro-
• 3-Chloropyridine-2-Acetic Acid

(3-chloropyridin-2-yl)acetic acid

CAS: 885167-73-7

Formula: C₇H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.5810

Ref: IN-DA003JBN

2-(3-Chloropyridin-2-yl)acetic acid

CAS: 885167-73-7

2-(3-Chloropyridin-2-yl)acetic acid

Purity: 95%

Molecular weight: 171.58g/mol

Ref: 54-OR76738

2-(3-Chloropyridin-2-yl)acetic acid

CAS: 885167-73-7

Formula: C₇H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F209569