
CAS 88521-63-5
:2-(2-Acetyl-4-nitrophenoxy)acetic acid
Description:
2-(2-Acetyl-4-nitrophenoxy)acetic acid, with the CAS number 88521-63-5, is an organic compound characterized by its functional groups, which include an acetyl group, a nitro group, and a carboxylic acid. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. The acetyl group can participate in various chemical reactions, such as acylation and esterification. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential uses in the development of agrochemicals or as intermediates in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its chemical properties.
Formula:C10H9NO6
InChI:InChI=1S/C10H9NO6/c1-6(12)8-4-7(11(15)16)2-3-9(8)17-5-10(13)14/h2-4H,5H2,1H3,(H,13,14)
InChI key:InChIKey=PSUXXDHFQIYRSL-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(OCC(O)=O)C=CC(N(=O)=O)=C1
Synonyms:- 2-(2-Acetyl-4-nitrophenoxy)acetic acid
- 2-Acetyl-4-nitrophenoxyacetic acid
- Acetic acid, (2-acetyl-4-nitrophenoxy)-
- NSC 624899
- Acetic acid, 2-(2-acetyl-4-nitrophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
