CAS 88522-20-7

2,5-Dichloro-N-[4-(phenylamino)phenyl]benzenesulfonamide

Description:

2,5-Dichloro-N-[4-(phenylamino)phenyl]benzenesulfonamide, identified by its CAS number 88522-20-7, is a chemical compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. The compound contains two chlorine atoms at the 2 and 5 positions of the benzene ring, contributing to its reactivity and potential biological activity. The presence of the phenylamino group enhances its ability to interact with biological targets, making it of interest in medicinal chemistry. Typically, compounds of this nature may exhibit antibacterial or antitumor properties, although specific biological activities would depend on further empirical studies. The molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could influence its solubility and stability in various solvents. As with many sulfonamides, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₈H₁₄Cl₂N₂O₂S

InChI: InChI=1S/C18H14Cl2N2O2S/c19-13-6-11-17(20)18(12-13)25(23,24)22-16-9-7-15(8-10-16)21-14-4-2-1-3-5-14/h1-12,21-22H

InChI key: InChIKey=QGPMRXZRZVXFSF-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(NC2=CC=CC=C2)C=C1)(=O)(=O)C3=C(Cl)C=CC(Cl)=C3

Synonyms:

• 2,5-Dichloro-N-[4-(phenylamino)phenyl]benzenesulfonamide
• Benzenesulfonamide, 2,5-dichloro-N-[4-(phenylamino)phenyl]-

Benzenesulfonamide, 2,5-dichloro-N-[4-(phenylamino)phenyl]-

CAS: 88522-20-7

Formula: C₁₈H₁₄Cl₂N₂O₂S

Molecular weight: 393.287

Ref: IN-DA004827