CymitQuimica logo

CAS 88522-39-8

:

2,5-Dichloro-N-[4-[1-(propylimino)ethyl]phenyl]benzenesulfonamide

Description:
2,5-Dichloro-N-[4-[1-(propylimino)ethyl]phenyl]benzenesulfonamide, with the CAS number 88522-39-8, is a synthetic organic compound characterized by its complex structure, which includes a sulfonamide functional group and multiple chlorine substituents. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although specific biological activities can vary based on its structural nuances. The presence of dichloro groups suggests increased reactivity and potential for interactions with biological targets. The propylimino group indicates the presence of an imine, which can influence the compound's stability and reactivity. In terms of solubility, sulfonamides generally have moderate solubility in polar solvents, which can affect their bioavailability and pharmacokinetics. The compound's molecular structure may also confer specific physicochemical properties, such as melting point and boiling point, which are essential for applications in pharmaceuticals or agrochemicals. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and related fields.
Formula:C17H18Cl2N2O2S
InChI:InChI=1S/C17H18Cl2N2O2S/c1-3-10-20-12(2)13-4-7-15(8-5-13)21-24(22,23)17-11-14(18)6-9-16(17)19/h4-9,11,21H,3,10H2,1-2H3
InChI key:InChIKey=XPYZTZMWUKAHNR-UHFFFAOYSA-N
SMILES:S(NC1=CC=C(C(=NCCC)C)C=C1)(=O)(=O)C2=C(Cl)C=CC(Cl)=C2
Synonyms:
  • Benzenesulfonamide, 2,5-dichloro-N-[4-[1-(propylimino)ethyl]phenyl]-
  • 2,5-Dichloro-N-[4-[1-(propylimino)ethyl]phenyl]benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.